C28H27N5O4 — CID 174239477
5-[2-[4-[3-[[2-[1-(oxan-2-yloxy)ethyl]imidazol-1-yl]methyl]-1,2-oxazol-5-yl]phenyl]ethynyl]pyridine-2-carboxamide (PubChem CID 174239477) has the molecular formula C28H27N5O4 and a molecular weight of 497.56 g/mol. Its IUPAC name is 5-[2-[4-[3-[[2-[1-(oxan-2-yloxy)ethyl]imidazol-1-yl]methyl]-1,2-oxazol-5-yl]phenyl]ethynyl]pyridine-2-carboxamide.
| Compound Name | 5-[2-[4-[3-[[2-[1-(oxan-2-yloxy)ethyl]imidazol-1-yl]methyl]-1,2-oxazol-5-yl]phenyl]ethynyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 174239477 |
| Molecular Formula | C28H27N5O4 |
| Molecular Weight | 497.56 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | 5-[2-[4-[3-[[2-[1-(oxan-2-yloxy)ethyl]imidazol-1-yl]methyl]-1,2-oxazol-5-yl]phenyl]ethynyl]pyridine-2-carboxamide |
| SMILES | CC(OC1CCCCO1)c1nccn1Cc1cc(-c2ccc(C#Cc3ccc(C(N)=O)nc3)cc2)on1 |
| InChI | InChI=1S/C28H27N5O4/c1-19(36-26-4-2-3-15-35-26)28-30-13-14-33(28)18-23-16-25(37-32-23)22-10-7-20(8-11-22)5-6-21-9-12-24(27(29)34)31-17-21/h7-14,16-17,19,26H,2-4,15,18H2,1H3,(H2,29,34) |
| InChIKey | VGDHJVKAYMRZSS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 118.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.56 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|