C25H28N2O5 — CID 174235177
4-[4-[4-[4-hydroxy-3-[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]but-1-ynyl]phenyl]phenoxy]butane-1,2-diol (PubChem CID 174235177) has the molecular formula C25H28N2O5 and a molecular weight of 436.51 g/mol. Its IUPAC name is 4-[4-[4-[4-hydroxy-3-[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]but-1-ynyl]phenyl]phenoxy]butane-1,2-diol.
| Compound Name | 4-[4-[4-[4-hydroxy-3-[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]but-1-ynyl]phenyl]phenoxy]butane-1,2-diol |
|---|---|
| PubChem CID | 174235177 |
| Molecular Formula | C25H28N2O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 4-[4-[4-[4-hydroxy-3-[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]but-1-ynyl]phenyl]phenoxy]butane-1,2-diol |
| SMILES | C[C@H](O)c1nccn1C(C#Cc1ccc(-c2ccc(OCCC(O)CO)cc2)cc1)CO |
| InChI | InChI=1S/C25H28N2O5/c1-18(30)25-26-13-14-27(25)22(16-28)9-4-19-2-5-20(6-3-19)21-7-10-24(11-8-21)32-15-12-23(31)17-29/h2-3,5-8,10-11,13-14,18,22-23,28-31H,12,15-17H2,1H3/t18-,22?,23?/m0/s1 |
| InChIKey | LRNUMDGXXMWNDK-NWLLBJEDSA-N |
| XLogP | 2.31 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|