C25H27N4O7P — CID 177228151
[(2S)-4-[4-[4-(1-carbamoylazetidin-3-yl)oxyphenyl]phenyl]-2-[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]but-3-ynyl] dihydrogen phosphate (PubChem CID 177228151) has the molecular formula C25H27N4O7P and a molecular weight of 526.49 g/mol. Its IUPAC name is [(2S)-4-[4-[4-(1-carbamoylazetidin-3-yl)oxyphenyl]phenyl]-2-[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]but-3-ynyl] dihydrogen phosphate.
| Compound Name | [(2S)-4-[4-[4-(1-carbamoylazetidin-3-yl)oxyphenyl]phenyl]-2-[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]but-3-ynyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 177228151 |
| Molecular Formula | C25H27N4O7P |
| Molecular Weight | 526.49 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | [(2S)-4-[4-[4-(1-carbamoylazetidin-3-yl)oxyphenyl]phenyl]-2-[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]but-3-ynyl] dihydrogen phosphate |
| SMILES | C[C@H](O)c1nccn1[C@@H](C#Cc1ccc(-c2ccc(OC3CN(C(N)=O)C3)cc2)cc1)COP(=O)(O)O |
| InChI | InChI=1S/C25H27N4O7P/c1-17(30)24-27-12-13-29(24)21(16-35-37(32,33)34)9-4-18-2-5-19(6-3-18)20-7-10-22(11-8-20)36-23-14-28(15-23)25(26)31/h2-3,5-8,10-13,17,21,23,30H,14-16H2,1H3,(H2,26,31)(H2,32,33,34)/t17-,21-/m0/s1 |
| InChIKey | OEBPIEXFUJNCMQ-UWJYYQICSA-N |
| XLogP | 2.45 |
| TPSA | 160.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.49 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|