C26H30N2O5 — CID 174238330
5-[4-[4-[4-hydroxy-3-[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]but-1-ynyl]phenyl]phenoxy]pentane-1,4-diol (PubChem CID 174238330) has the molecular formula C26H30N2O5 and a molecular weight of 450.54 g/mol. Its IUPAC name is 5-[4-[4-[4-hydroxy-3-[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]but-1-ynyl]phenyl]phenoxy]pentane-1,4-diol.
| Compound Name | 5-[4-[4-[4-hydroxy-3-[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]but-1-ynyl]phenyl]phenoxy]pentane-1,4-diol |
|---|---|
| PubChem CID | 174238330 |
| Molecular Formula | C26H30N2O5 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | 5-[4-[4-[4-hydroxy-3-[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]but-1-ynyl]phenyl]phenoxy]pentane-1,4-diol |
| SMILES | C[C@H](O)c1nccn1C(C#Cc1ccc(-c2ccc(OCC(O)CCCO)cc2)cc1)CO |
| InChI | InChI=1S/C26H30N2O5/c1-19(31)26-27-14-15-28(26)23(17-30)11-6-20-4-7-21(8-5-20)22-9-12-25(13-10-22)33-18-24(32)3-2-16-29/h4-5,7-10,12-15,19,23-24,29-32H,2-3,16-18H2,1H3/t19-,23?,24?/m0/s1 |
| InChIKey | BYEZIUAUIAPXAW-HLJPNSHOSA-N |
| XLogP | 2.70 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|