C27H30N3O7P — CID 177228125
[(2S)-2-[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]-4-[4-[4-[3-(methylcarbamoyl)cyclobutyl]oxyphenyl]phenyl]but-3-ynyl] dihydrogen phosphate (PubChem CID 177228125) has the molecular formula C27H30N3O7P and a molecular weight of 539.53 g/mol. Its IUPAC name is [(2S)-2-[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]-4-[4-[4-[3-(methylcarbamoyl)cyclobutyl]oxyphenyl]phenyl]but-3-ynyl] dihydrogen phosphate.
| Compound Name | [(2S)-2-[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]-4-[4-[4-[3-(methylcarbamoyl)cyclobutyl]oxyphenyl]phenyl]but-3-ynyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 177228125 |
| Molecular Formula | C27H30N3O7P |
| Molecular Weight | 539.53 g/mol |
| Exact Mass | 539.18 |
| IUPAC Name | [(2S)-2-[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]-4-[4-[4-[3-(methylcarbamoyl)cyclobutyl]oxyphenyl]phenyl]but-3-ynyl] dihydrogen phosphate |
| SMILES | CNC(=O)C1CC(Oc2ccc(-c3ccc(C#C[C@@H](COP(=O)(O)O)n4ccnc4[C@H](C)O)cc3)cc2)C1 |
| InChI | InChI=1S/C27H30N3O7P/c1-18(31)26-29-13-14-30(26)23(17-36-38(33,34)35)10-5-19-3-6-20(7-4-19)21-8-11-24(12-9-21)37-25-15-22(16-25)27(32)28-2/h3-4,6-9,11-14,18,22-23,25,31H,15-17H2,1-2H3,(H,28,32)(H2,33,34,35)/t18-,22?,23-,25?/m0/s1 |
| InChIKey | DYAXBOIVYVUPCC-XGWAMKGJSA-N |
| XLogP | 3.21 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.53 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|