C25H28N2O8PSi — CID 177228157
CID 177228157 (PubChem CID 177228157) has the molecular formula C25H28N2O8PSi and a molecular weight of 543.57 g/mol.
| Compound Name | CID 177228157 |
|---|---|
| PubChem CID | 177228157 |
| Molecular Formula | C25H28N2O8PSi |
| Molecular Weight | 543.57 g/mol |
| Exact Mass | 543.14 |
| IUPAC Name | — |
| SMILES | Cc1cc(-c2ccc(C#C[C@@H](COP(=O)(O)O)n3ccnc3[Si](C)O)cc2)ccc1O[C@@H]1COC[C@H]1O |
| InChI | InChI=1S/C25H28N2O8PSi/c1-17-13-20(8-10-23(17)35-24-16-33-15-22(24)28)19-6-3-18(4-7-19)5-9-21(14-34-36(29,30)31)27-12-11-26-25(27)37(2)32/h3-4,6-8,10-13,21-22,24,28,32H,14-16H2,1-2H3,(H2,29,30,31)/t21-,22+,24+/m0/s1 |
| InChIKey | BRFZDSQWKFGJEQ-WMTXJRDZSA-N |
| XLogP | 1.52 |
| TPSA | 143.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.57 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|