C30H35N2O5Si — CID 170792683
CID 170792683 (PubChem CID 170792683) has the molecular formula C30H35N2O5Si and a molecular weight of 531.71 g/mol.
| Compound Name | CID 170792683 |
|---|---|
| PubChem CID | 170792683 |
| Molecular Formula | C30H35N2O5Si |
| Molecular Weight | 531.71 g/mol |
| Exact Mass | 531.23 |
| IUPAC Name | — |
| SMILES | Cc1cc(-c2ccc(C#C[C@@H](CO)n3ccnc3[Si](C)OC3CCCCO3)cc2)ccc1O[C@H]1CCOC1 |
| InChI | InChI=1S/C30H35N2O5Si/c1-22-19-25(11-13-28(22)36-27-14-18-34-21-27)24-9-6-23(7-10-24)8-12-26(20-33)32-16-15-31-30(32)38(2)37-29-5-3-4-17-35-29/h6-7,9-11,13,15-16,19,26-27,29,33H,3-5,14,17-18,20-21H2,1-2H3/t26-,27-,29?/m0/s1 |
| InChIKey | YEJWQLKIFYXFMU-DARYULOESA-N |
| XLogP | 3.98 |
| TPSA | 74.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.71 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|