C15H18O3 — CID 63563810
4-[3-methyl-4-(oxolan-3-yloxy)phenyl]but-3-yn-1-ol (PubChem CID 63563810) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is 4-[3-methyl-4-(oxolan-3-yloxy)phenyl]but-3-yn-1-ol.
| Compound Name | 4-[3-methyl-4-(oxolan-3-yloxy)phenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 63563810 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 4-[3-methyl-4-(oxolan-3-yloxy)phenyl]but-3-yn-1-ol |
| SMILES | Cc1cc(C#CCCO)ccc1OC1CCOC1 |
| InChI | InChI=1S/C15H18O3/c1-12-10-13(4-2-3-8-16)5-6-15(12)18-14-7-9-17-11-14/h5-6,10,14,16H,3,7-9,11H2,1H3 |
| InChIKey | WEVDJOGIWULVIP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|