C26H28N2O5 — CID 170792487
(4R)-3-[4-[4-[(3S)-4-hydroxy-3-[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]but-1-ynyl]phenyl]phenoxy]oxan-4-ol (PubChem CID 170792487) has the molecular formula C26H28N2O5 and a molecular weight of 448.52 g/mol. Its IUPAC name is (4R)-3-[4-[4-[(3S)-4-hydroxy-3-[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]but-1-ynyl]phenyl]phenoxy]oxan-4-ol.
| Compound Name | (4R)-3-[4-[4-[(3S)-4-hydroxy-3-[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]but-1-ynyl]phenyl]phenoxy]oxan-4-ol |
|---|---|
| PubChem CID | 170792487 |
| Molecular Formula | C26H28N2O5 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | (4R)-3-[4-[4-[(3S)-4-hydroxy-3-[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]but-1-ynyl]phenyl]phenoxy]oxan-4-ol |
| SMILES | C[C@H](O)c1nccn1[C@@H](C#Cc1ccc(-c2ccc(OC3COCC[C@H]3O)cc2)cc1)CO |
| InChI | InChI=1S/C26H28N2O5/c1-18(30)26-27-13-14-28(26)22(16-29)9-4-19-2-5-20(6-3-19)21-7-10-23(11-8-21)33-25-17-32-15-12-24(25)31/h2-3,5-8,10-11,13-14,18,22,24-25,29-31H,12,15-17H2,1H3/t18-,22-,24+,25?/m0/s1 |
| InChIKey | FDQPQOHIDGLXCZ-ZDWJHTQHSA-N |
| XLogP | 2.72 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|