C24H26N2O4 — CID 177227523
(2S)-2-[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]-4-[4-[4-[(2R)-2-hydroxypropoxy]phenyl]phenyl]but-3-yn-1-ol (PubChem CID 177227523) has the molecular formula C24H26N2O4 and a molecular weight of 406.48 g/mol. Its IUPAC name is (2S)-2-[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]-4-[4-[4-[(2R)-2-hydroxypropoxy]phenyl]phenyl]but-3-yn-1-ol.
| Compound Name | (2S)-2-[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]-4-[4-[4-[(2R)-2-hydroxypropoxy]phenyl]phenyl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 177227523 |
| Molecular Formula | C24H26N2O4 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | (2S)-2-[2-[(1S)-1-hydroxyethyl]imidazol-1-yl]-4-[4-[4-[(2R)-2-hydroxypropoxy]phenyl]phenyl]but-3-yn-1-ol |
| SMILES | C[C@H](O)c1nccn1[C@@H](C#Cc1ccc(-c2ccc(OC[C@@H](C)O)cc2)cc1)CO |
| InChI | InChI=1S/C24H26N2O4/c1-17(28)16-30-23-11-8-21(9-12-23)20-6-3-19(4-7-20)5-10-22(15-27)26-14-13-25-24(26)18(2)29/h3-4,6-9,11-14,17-18,22,27-29H,15-16H2,1-2H3/t17-,18+,22+/m1/s1 |
| InChIKey | GABNERSHKWUCHC-FGSXEWAUSA-N |
| XLogP | 2.95 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|