C17H20O7S — CID 102331497
(7S,10R,11R)-11-hydroxy-10-methoxy-3,3-dimethyl-7-phenylsulfanyl-2,4,9-trioxaspiro[5.5]undecane-1,5-dione (PubChem CID 102331497) has the molecular formula C17H20O7S and a molecular weight of 368.41 g/mol. Its IUPAC name is (7S,10R,11R)-11-hydroxy-10-methoxy-3,3-dimethyl-7-phenylsulfanyl-2,4,9-trioxaspiro[5.5]undecane-1,5-dione.
| Compound Name | (7S,10R,11R)-11-hydroxy-10-methoxy-3,3-dimethyl-7-phenylsulfanyl-2,4,9-trioxaspiro[5.5]undecane-1,5-dione |
|---|---|
| PubChem CID | 102331497 |
| Molecular Formula | C17H20O7S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | (7S,10R,11R)-11-hydroxy-10-methoxy-3,3-dimethyl-7-phenylsulfanyl-2,4,9-trioxaspiro[5.5]undecane-1,5-dione |
| SMILES | CO[C@@H]1OC[C@@H](Sc2ccccc2)C2(C(=O)OC(C)(C)OC2=O)[C@H]1O |
| InChI | InChI=1S/C17H20O7S/c1-16(2)23-14(19)17(15(20)24-16)11(9-22-13(21-3)12(17)18)25-10-7-5-4-6-8-10/h4-8,11-13,18H,9H2,1-3H3/t11-,12+,13-/m1/s1 |
| InChIKey | ZOTGQFWTJRHIOZ-FRRDWIJNSA-N |
| XLogP | 1.33 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|