C24H36O11S — CID 159704134
[(3S,5R,6R)-5-acetyloxy-3,4-dimethyl-6-phenylsulfanyloxan-2-yl]methyl acetate;(2S,3R,5S)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol (PubChem CID 159704134) has the molecular formula C24H36O11S and a molecular weight of 532.61 g/mol. Its IUPAC name is [(3S,5R,6R)-5-acetyloxy-3,4-dimethyl-6-phenylsulfanyloxan-2-yl]methyl acetate;(2S,3R,5S)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol.
| Compound Name | [(3S,5R,6R)-5-acetyloxy-3,4-dimethyl-6-phenylsulfanyloxan-2-yl]methyl acetate;(2S,3R,5S)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 159704134 |
| Molecular Formula | C24H36O11S |
| Molecular Weight | 532.61 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | [(3S,5R,6R)-5-acetyloxy-3,4-dimethyl-6-phenylsulfanyloxan-2-yl]methyl acetate;(2S,3R,5S)-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| SMILES | CC(=O)OCC1O[C@H](Sc2ccccc2)[C@H](OC(C)=O)C(C)[C@@H]1C.OCC1O[C@H](O)[C@H](O)C(O)[C@@H]1O |
| InChI | InChI=1S/C18H24O5S.C6H12O6/c1-11-12(2)17(22-14(4)20)18(23-16(11)10-21-13(3)19)24-15-8-6-5-7-9-15;7-1-2-3(8)4(9)5(10)6(11)12-2/h5-9,11-12,16-18H,10H2,1-4H3;2-11H,1H2/t11-,12?,16?,17+,18+;2?,3-,4?,5-,6+/m01/s1 |
| InChIKey | MXZNGXLYCVUMKY-JJEIIEDOSA-N |
| XLogP | 0.05 |
| TPSA | 172.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.61 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |