C24H32O11S — CID 146169996
[(3S,6S)-4,5-diacetyloxy-6-[(3S,6S)-3,5-dihydroxy-2-methyl-6-phenylsulfanyloxan-4-yl]oxy-2-methyloxan-3-yl] acetate (PubChem CID 146169996) has the molecular formula C24H32O11S and a molecular weight of 528.58 g/mol. Its IUPAC name is [(3S,6S)-4,5-diacetyloxy-6-[(3S,6S)-3,5-dihydroxy-2-methyl-6-phenylsulfanyloxan-4-yl]oxy-2-methyloxan-3-yl] acetate.
| Compound Name | [(3S,6S)-4,5-diacetyloxy-6-[(3S,6S)-3,5-dihydroxy-2-methyl-6-phenylsulfanyloxan-4-yl]oxy-2-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 146169996 |
| Molecular Formula | C24H32O11S |
| Molecular Weight | 528.58 g/mol |
| Exact Mass | 528.17 |
| IUPAC Name | [(3S,6S)-4,5-diacetyloxy-6-[(3S,6S)-3,5-dihydroxy-2-methyl-6-phenylsulfanyloxan-4-yl]oxy-2-methyloxan-3-yl] acetate |
| SMILES | CC(=O)OC1C(OC(C)=O)[C@@H](OC(C)=O)C(C)O[C@H]1OC1C(O)[C@H](Sc2ccccc2)OC(C)[C@@H]1O |
| InChI | InChI=1S/C24H32O11S/c1-11-17(28)20(18(29)24(31-11)36-16-9-7-6-8-10-16)35-23-22(34-15(5)27)21(33-14(4)26)19(12(2)30-23)32-13(3)25/h6-12,17-24,28-29H,1-5H3/t11?,12?,17-,18?,19-,20?,21?,22?,23-,24-/m0/s1 |
| InChIKey | CQPWWNXHKVGKMR-RUSGZWCZSA-N |
| XLogP | 1.17 |
| TPSA | 147.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.58 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|