C21H30O7S — CID 10025494
[(2S)-2-[(4S,4aS,8aR)-2,2,4a,6,6-pentamethyl-8,8a-dihydro-4H-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]-2-hydroxy-1-phenylsulfanylethyl] acetate (PubChem CID 10025494) has the molecular formula C21H30O7S and a molecular weight of 426.53 g/mol. Its IUPAC name is [(2S)-2-[(4S,4aS,8aR)-2,2,4a,6,6-pentamethyl-8,8a-dihydro-4H-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]-2-hydroxy-1-phenylsulfanylethyl] acetate.
| Compound Name | [(2S)-2-[(4S,4aS,8aR)-2,2,4a,6,6-pentamethyl-8,8a-dihydro-4H-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]-2-hydroxy-1-phenylsulfanylethyl] acetate |
|---|---|
| PubChem CID | 10025494 |
| Molecular Formula | C21H30O7S |
| Molecular Weight | 426.53 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | [(2S)-2-[(4S,4aS,8aR)-2,2,4a,6,6-pentamethyl-8,8a-dihydro-4H-[1,3]dioxino[5,4-d][1,3]dioxin-4-yl]-2-hydroxy-1-phenylsulfanylethyl] acetate |
| SMILES | CC(=O)OC(Sc1ccccc1)[C@@H](O)[C@@H]1OC(C)(C)O[C@@H]2COC(C)(C)O[C@@]21C |
| InChI | InChI=1S/C21H30O7S/c1-13(22)25-18(29-14-10-8-7-9-11-14)16(23)17-21(6)15(26-20(4,5)27-17)12-24-19(2,3)28-21/h7-11,15-18,23H,12H2,1-6H3/t15-,16+,17+,18?,21+/m1/s1 |
| InChIKey | HSQRLHKEPRGLIT-KQFYGTFESA-N |
| XLogP | 3.09 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.53 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|