C22H33FO4S — CID 134903398
(2R,3R,4R,6S,8R)-2-butan-2-yl-4-(4-fluorophenyl)sulfanyl-10-methoxy-3,8-dimethyl-1,7-dioxaspiro[5.5]undecan-3-ol (PubChem CID 134903398) has the molecular formula C22H33FO4S and a molecular weight of 412.57 g/mol. Its IUPAC name is (2R,3R,4R,6S,8R)-2-butan-2-yl-4-(4-fluorophenyl)sulfanyl-10-methoxy-3,8-dimethyl-1,7-dioxaspiro[5.5]undecan-3-ol.
| Compound Name | (2R,3R,4R,6S,8R)-2-butan-2-yl-4-(4-fluorophenyl)sulfanyl-10-methoxy-3,8-dimethyl-1,7-dioxaspiro[5.5]undecan-3-ol |
|---|---|
| PubChem CID | 134903398 |
| Molecular Formula | C22H33FO4S |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | (2R,3R,4R,6S,8R)-2-butan-2-yl-4-(4-fluorophenyl)sulfanyl-10-methoxy-3,8-dimethyl-1,7-dioxaspiro[5.5]undecan-3-ol |
| SMILES | CCC(C)[C@H]1O[C@@]2(CC(OC)C[C@@H](C)O2)C[C@@H](Sc2ccc(F)cc2)[C@]1(C)O |
| InChI | InChI=1S/C22H33FO4S/c1-6-14(2)20-21(4,24)19(28-18-9-7-16(23)8-10-18)13-22(27-20)12-17(25-5)11-15(3)26-22/h7-10,14-15,17,19-20,24H,6,11-13H2,1-5H3/t14?,15-,17?,19-,20-,21+,22+/m1/s1 |
| InChIKey | KYFXVINHGXPJAN-TUQWVKJYSA-N |
| XLogP | 4.78 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |