C18H26O4S — CID 14167466
(2R,4S,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-phenylsulfanylhept-6-ene-2,4-diol (PubChem CID 14167466) has the molecular formula C18H26O4S and a molecular weight of 338.47 g/mol. Its IUPAC name is (2R,4S,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-phenylsulfanylhept-6-ene-2,4-diol.
| Compound Name | (2R,4S,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-phenylsulfanylhept-6-ene-2,4-diol |
|---|---|
| PubChem CID | 14167466 |
| Molecular Formula | C18H26O4S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | (2R,4S,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-phenylsulfanylhept-6-ene-2,4-diol |
| SMILES | C=C[C@H]([C@@H]1COC(C)(C)O1)[C@@H](O)C[C@@H](O)CSc1ccccc1 |
| InChI | InChI=1S/C18H26O4S/c1-4-15(17-11-21-18(2,3)22-17)16(20)10-13(19)12-23-14-8-6-5-7-9-14/h4-9,13,15-17,19-20H,1,10-12H2,2-3H3/t13-,15+,16+,17+/m1/s1 |
| InChIKey | FASVYAPEEJSAAL-IWCQGFGOSA-N |
| XLogP | 2.84 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|