C16H22O5S — CID 134844362
[(2R,3R,4S,5R)-4-(benzenesulfonylmethyl)-3-methoxy-5-prop-2-enyloxolan-2-yl]methanol (PubChem CID 134844362) has the molecular formula C16H22O5S and a molecular weight of 326.41 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-4-(benzenesulfonylmethyl)-3-methoxy-5-prop-2-enyloxolan-2-yl]methanol.
| Compound Name | [(2R,3R,4S,5R)-4-(benzenesulfonylmethyl)-3-methoxy-5-prop-2-enyloxolan-2-yl]methanol |
|---|---|
| PubChem CID | 134844362 |
| Molecular Formula | C16H22O5S |
| Molecular Weight | 326.41 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | [(2R,3R,4S,5R)-4-(benzenesulfonylmethyl)-3-methoxy-5-prop-2-enyloxolan-2-yl]methanol |
| SMILES | C=CC[C@H]1O[C@H](CO)[C@H](OC)[C@H]1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H22O5S/c1-3-7-14-13(16(20-2)15(10-17)21-14)11-22(18,19)12-8-5-4-6-9-12/h3-6,8-9,13-17H,1,7,10-11H2,2H3/t13-,14+,15+,16+/m0/s1 |
| InChIKey | ZGHFAZGJFOVVHX-ZJIFWQFVSA-N |
| XLogP | 1.43 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.41 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|