C29H42O4S — CID 10983762
2-[(1R,2R,6S,10E,14S)-2,4,4,11,15-pentamethyl-9-phenylsulfanyl-3,5,18-trioxatricyclo[12.3.1.02,6]octadeca-10,15-dien-8-yl]propan-2-ol (PubChem CID 10983762) has the molecular formula C29H42O4S and a molecular weight of 486.72 g/mol. Its IUPAC name is 2-[(1R,2R,6S,10E,14S)-2,4,4,11,15-pentamethyl-9-phenylsulfanyl-3,5,18-trioxatricyclo[12.3.1.02,6]octadeca-10,15-dien-8-yl]propan-2-ol.
| Compound Name | 2-[(1R,2R,6S,10E,14S)-2,4,4,11,15-pentamethyl-9-phenylsulfanyl-3,5,18-trioxatricyclo[12.3.1.02,6]octadeca-10,15-dien-8-yl]propan-2-ol |
|---|---|
| PubChem CID | 10983762 |
| Molecular Formula | C29H42O4S |
| Molecular Weight | 486.72 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | 2-[(1R,2R,6S,10E,14S)-2,4,4,11,15-pentamethyl-9-phenylsulfanyl-3,5,18-trioxatricyclo[12.3.1.02,6]octadeca-10,15-dien-8-yl]propan-2-ol |
| SMILES | CC1=CC[C@H]2O[C@H]1CC/C(C)=C/C(Sc1ccccc1)C(C(C)(C)O)C[C@@H]1OC(C)(C)O[C@@]12C |
| InChI | InChI=1S/C29H42O4S/c1-19-13-15-23-20(2)14-16-25(31-23)29(7)26(32-28(5,6)33-29)18-22(27(3,4)30)24(17-19)34-21-11-9-8-10-12-21/h8-12,14,17,22-26,30H,13,15-16,18H2,1-7H3/b19-17+/t22?,23-,24?,25+,26-,29+/m0/s1 |
| InChIKey | CYPRRMUGAAMNEJ-ODVCYQEDSA-N |
| XLogP | 6.68 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.72 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|