C19H26O4S — CID 134936782
(4S)-4-[(1S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl]-6-(phenylsulfanylmethyl)-1,3-dioxane (PubChem CID 134936782) has the molecular formula C19H26O4S and a molecular weight of 350.48 g/mol. Its IUPAC name is (4S)-4-[(1S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl]-6-(phenylsulfanylmethyl)-1,3-dioxane.
| Compound Name | (4S)-4-[(1S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl]-6-(phenylsulfanylmethyl)-1,3-dioxane |
|---|---|
| PubChem CID | 134936782 |
| Molecular Formula | C19H26O4S |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | (4S)-4-[(1S)-1-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enyl]-6-(phenylsulfanylmethyl)-1,3-dioxane |
| SMILES | C=C[C@@H]([C@@H]1CC(CSc2ccccc2)OCO1)[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C19H26O4S/c1-4-16(18-11-22-19(2,3)23-18)17-10-14(20-13-21-17)12-24-15-8-6-5-7-9-15/h4-9,14,16-18H,1,10-13H2,2-3H3/t14?,16-,17-,18-/m0/s1 |
| InChIKey | BEECKIBMNZULKS-ZWBPCXSVSA-N |
| XLogP | 3.86 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|