C19H28AcO4S — CID 18716221
actinium;[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-ethyl-4-methyloxolan-3-yl]-phenylsulfanylmethanol (PubChem CID 18716221) has the molecular formula C19H28AcO4S and a molecular weight of 579.50 g/mol. Its IUPAC name is actinium;[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-ethyl-4-methyloxolan-3-yl]-phenylsulfanylmethanol.
| Compound Name | actinium;[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-ethyl-4-methyloxolan-3-yl]-phenylsulfanylmethanol |
|---|---|
| PubChem CID | 18716221 |
| Molecular Formula | C19H28AcO4S |
| Molecular Weight | 579.50 g/mol |
| Exact Mass | 579.20 |
| IUPAC Name | actinium;[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2-ethyl-4-methyloxolan-3-yl]-phenylsulfanylmethanol |
| SMILES | CCC1OC(C2COC(C)(C)O2)C(C)C1C(O)Sc1ccccc1.[Ac] |
| InChI | InChI=1S/C19H28O4S.Ac/c1-5-14-16(18(20)24-13-9-7-6-8-10-13)12(2)17(22-14)15-11-21-19(3,4)23-15;/h6-10,12,14-18,20H,5,11H2,1-4H3; |
| InChIKey | CXVLSHKYGAESII-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.50 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|