C16H20O6S2 — CID 134844825
[(3R,6R)-6-hydroxy-2-methyl-4-methylsulfanylcarbonyloxy-5-phenylsulfanyloxan-3-yl] acetate (PubChem CID 134844825) has the molecular formula C16H20O6S2 and a molecular weight of 372.46 g/mol. Its IUPAC name is [(3R,6R)-6-hydroxy-2-methyl-4-methylsulfanylcarbonyloxy-5-phenylsulfanyloxan-3-yl] acetate.
| Compound Name | [(3R,6R)-6-hydroxy-2-methyl-4-methylsulfanylcarbonyloxy-5-phenylsulfanyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 134844825 |
| Molecular Formula | C16H20O6S2 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | [(3R,6R)-6-hydroxy-2-methyl-4-methylsulfanylcarbonyloxy-5-phenylsulfanyloxan-3-yl] acetate |
| SMILES | CSC(=O)OC1C(Sc2ccccc2)[C@H](O)OC(C)[C@H]1OC(C)=O |
| InChI | InChI=1S/C16H20O6S2/c1-9-12(21-10(2)17)13(22-16(19)23-3)14(15(18)20-9)24-11-7-5-4-6-8-11/h4-9,12-15,18H,1-3H3/t9?,12-,13?,14?,15-/m1/s1 |
| InChIKey | YSJJUTBESYQWEG-GKGHAMHASA-N |
| XLogP | 2.68 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|