C16H20O4S — CID 14245805
2,2-dimethyl-5-(1-phenylsulfanylbutyl)-1,3-dioxane-4,6-dione (PubChem CID 14245805) has the molecular formula C16H20O4S and a molecular weight of 308.40 g/mol. Its IUPAC name is 2,2-dimethyl-5-(1-phenylsulfanylbutyl)-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-(1-phenylsulfanylbutyl)-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 14245805 |
| Molecular Formula | C16H20O4S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 2,2-dimethyl-5-(1-phenylsulfanylbutyl)-1,3-dioxane-4,6-dione |
| SMILES | CCCC(Sc1ccccc1)C1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C16H20O4S/c1-4-8-12(21-11-9-6-5-7-10-11)13-14(17)19-16(2,3)20-15(13)18/h5-7,9-10,12-13H,4,8H2,1-3H3 |
| InChIKey | IGLVYKDQQAOVKU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|