C20H30O6S — CID 134999995
ethyl (3R)-2-(benzenesulfonyl)-4-methyl-3-[(6S)-6-methyloxan-2-yl]oxypentanoate (PubChem CID 134999995) has the molecular formula C20H30O6S and a molecular weight of 398.52 g/mol. Its IUPAC name is ethyl (3R)-2-(benzenesulfonyl)-4-methyl-3-[(6S)-6-methyloxan-2-yl]oxypentanoate.
| Compound Name | ethyl (3R)-2-(benzenesulfonyl)-4-methyl-3-[(6S)-6-methyloxan-2-yl]oxypentanoate |
|---|---|
| PubChem CID | 134999995 |
| Molecular Formula | C20H30O6S |
| Molecular Weight | 398.52 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | ethyl (3R)-2-(benzenesulfonyl)-4-methyl-3-[(6S)-6-methyloxan-2-yl]oxypentanoate |
| SMILES | CCOC(=O)C([C@H](OC1CCC[C@H](C)O1)C(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H30O6S/c1-5-24-20(21)19(27(22,23)16-11-7-6-8-12-16)18(14(2)3)26-17-13-9-10-15(4)25-17/h6-8,11-12,14-15,17-19H,5,9-10,13H2,1-4H3/t15-,17?,18+,19?/m0/s1 |
| InChIKey | ZQQDIGZVOLOPPL-WEOZKBJRSA-N |
| XLogP | 3.35 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.52 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |