C15H18O5S — CID 15437502
methyl 3-(benzenesulfonyl)-2-ethenyloxane-3-carboxylate (PubChem CID 15437502) has the molecular formula C15H18O5S and a molecular weight of 310.37 g/mol. Its IUPAC name is methyl 3-(benzenesulfonyl)-2-ethenyloxane-3-carboxylate.
| Compound Name | methyl 3-(benzenesulfonyl)-2-ethenyloxane-3-carboxylate |
|---|---|
| PubChem CID | 15437502 |
| Molecular Formula | C15H18O5S |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | methyl 3-(benzenesulfonyl)-2-ethenyloxane-3-carboxylate |
| SMILES | C=CC1OCCCC1(C(=O)OC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H18O5S/c1-3-13-15(14(16)19-2,10-7-11-20-13)21(17,18)12-8-5-4-6-9-12/h3-6,8-9,13H,1,7,10-11H2,2H3 |
| InChIKey | HMRUGUNBJBSHRH-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|