C20H20O8S — CID 10002207
dimethyl 2-[2-(benzenesulfonyl)buta-2,3-dienyl]-2-[(5-oxo-2H-furan-3-yl)methyl]propanedioate (PubChem CID 10002207) has the molecular formula C20H20O8S and a molecular weight of 420.44 g/mol. Its IUPAC name is dimethyl 2-[2-(benzenesulfonyl)buta-2,3-dienyl]-2-[(5-oxo-2H-furan-3-yl)methyl]propanedioate.
| Compound Name | dimethyl 2-[2-(benzenesulfonyl)buta-2,3-dienyl]-2-[(5-oxo-2H-furan-3-yl)methyl]propanedioate |
|---|---|
| PubChem CID | 10002207 |
| Molecular Formula | C20H20O8S |
| Molecular Weight | 420.44 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | dimethyl 2-[2-(benzenesulfonyl)buta-2,3-dienyl]-2-[(5-oxo-2H-furan-3-yl)methyl]propanedioate |
| SMILES | C=C=C(CC(CC1=CC(=O)OC1)(C(=O)OC)C(=O)OC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H20O8S/c1-4-15(29(24,25)16-8-6-5-7-9-16)12-20(18(22)26-2,19(23)27-3)11-14-10-17(21)28-13-14/h5-10H,1,11-13H2,2-3H3 |
| InChIKey | ZQGNDVYRHLJDBL-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.44 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|