C27H30O10S2 — CID 10579473
trimethyl (1E)-7,8-bis(benzenesulfonyl)nona-1,8-diene-1,5,5-tricarboxylate (PubChem CID 10579473) has the molecular formula C27H30O10S2 and a molecular weight of 578.66 g/mol. Its IUPAC name is trimethyl (1E)-7,8-bis(benzenesulfonyl)nona-1,8-diene-1,5,5-tricarboxylate.
| Compound Name | trimethyl (1E)-7,8-bis(benzenesulfonyl)nona-1,8-diene-1,5,5-tricarboxylate |
|---|---|
| PubChem CID | 10579473 |
| Molecular Formula | C27H30O10S2 |
| Molecular Weight | 578.66 g/mol |
| Exact Mass | 578.13 |
| IUPAC Name | trimethyl (1E)-7,8-bis(benzenesulfonyl)nona-1,8-diene-1,5,5-tricarboxylate |
| SMILES | C=C(C(CC(CC/C=C/C(=O)OC)(C(=O)OC)C(=O)OC)S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H30O10S2/c1-20(38(31,32)21-13-7-5-8-14-21)23(39(33,34)22-15-9-6-10-16-22)19-27(25(29)36-3,26(30)37-4)18-12-11-17-24(28)35-2/h5-11,13-17,23H,1,12,18-19H2,2-4H3/b17-11+ |
| InChIKey | RWPISIZBQZWOKD-GZTJUZNOSA-N |
| XLogP | 3.05 |
| TPSA | 147.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.66 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|