C19H18O4S — CID 102175214
methyl (2Z,4E)-2-(benzenesulfonylmethyl)-5-phenylpenta-2,4-dienoate (PubChem CID 102175214) has the molecular formula C19H18O4S and a molecular weight of 342.42 g/mol. Its IUPAC name is methyl (2Z,4E)-2-(benzenesulfonylmethyl)-5-phenylpenta-2,4-dienoate.
| Compound Name | methyl (2Z,4E)-2-(benzenesulfonylmethyl)-5-phenylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 102175214 |
| Molecular Formula | C19H18O4S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | methyl (2Z,4E)-2-(benzenesulfonylmethyl)-5-phenylpenta-2,4-dienoate |
| SMILES | COC(=O)/C(=C/C=C/c1ccccc1)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H18O4S/c1-23-19(20)17(12-8-11-16-9-4-2-5-10-16)15-24(21,22)18-13-6-3-7-14-18/h2-14H,15H2,1H3/b11-8+,17-12+ |
| InChIKey | IASMGQJRHNXPAO-OENGIGCFSA-N |
| XLogP | 3.27 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|