C23H26O8S — CID 10004532
dimethyl (3aR,4R)-6-(benzenesulfonyl)-4-[(E)-3-ethoxy-3-oxoprop-1-enyl]-3,3a,4,5-tetrahydro-1H-pentalene-2,2-dicarboxylate (PubChem CID 10004532) has the molecular formula C23H26O8S and a molecular weight of 462.52 g/mol. Its IUPAC name is dimethyl (3aR,4R)-6-(benzenesulfonyl)-4-[(E)-3-ethoxy-3-oxoprop-1-enyl]-3,3a,4,5-tetrahydro-1H-pentalene-2,2-dicarboxylate.
| Compound Name | dimethyl (3aR,4R)-6-(benzenesulfonyl)-4-[(E)-3-ethoxy-3-oxoprop-1-enyl]-3,3a,4,5-tetrahydro-1H-pentalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 10004532 |
| Molecular Formula | C23H26O8S |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | dimethyl (3aR,4R)-6-(benzenesulfonyl)-4-[(E)-3-ethoxy-3-oxoprop-1-enyl]-3,3a,4,5-tetrahydro-1H-pentalene-2,2-dicarboxylate |
| SMILES | CCOC(=O)/C=C/[C@H]1CC(S(=O)(=O)c2ccccc2)=C2CC(C(=O)OC)(C(=O)OC)C[C@@H]21 |
| InChI | InChI=1S/C23H26O8S/c1-4-31-20(24)11-10-15-12-19(32(27,28)16-8-6-5-7-9-16)18-14-23(13-17(15)18,21(25)29-2)22(26)30-3/h5-11,15,17H,4,12-14H2,1-3H3/b11-10+/t15-,17+/m0/s1 |
| InChIKey | DPWBTFHYWOGGLA-ALZIZJOTSA-N |
| XLogP | 2.60 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|