C20H22O8S — CID 10364932
trimethyl (3aS,6aR)-6a-(benzenesulfonyl)-3,4-dihydro-1H-pentalene-2,2,3a-tricarboxylate (PubChem CID 10364932) has the molecular formula C20H22O8S and a molecular weight of 422.46 g/mol. Its IUPAC name is trimethyl (3aS,6aR)-6a-(benzenesulfonyl)-3,4-dihydro-1H-pentalene-2,2,3a-tricarboxylate.
| Compound Name | trimethyl (3aS,6aR)-6a-(benzenesulfonyl)-3,4-dihydro-1H-pentalene-2,2,3a-tricarboxylate |
|---|---|
| PubChem CID | 10364932 |
| Molecular Formula | C20H22O8S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | trimethyl (3aS,6aR)-6a-(benzenesulfonyl)-3,4-dihydro-1H-pentalene-2,2,3a-tricarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@]2(C(=O)OC)CC=C[C@]2(S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C20H22O8S/c1-26-15(21)18(16(22)27-2)12-19(17(23)28-3)10-7-11-20(19,13-18)29(24,25)14-8-5-4-6-9-14/h4-9,11H,10,12-13H2,1-3H3/t19-,20-/m0/s1 |
| InChIKey | WTAJTPANPXCPMS-PMACEKPBSA-N |
| XLogP | 1.44 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|