C19H22O5S — CID 135010911
dimethyl (3aR,6aS)-4-oxo-3-(phenylsulfanylmethyl)-2,3,3a,5,6,6a-hexahydropentalene-1,1-dicarboxylate (PubChem CID 135010911) has the molecular formula C19H22O5S and a molecular weight of 362.45 g/mol. Its IUPAC name is dimethyl (3aR,6aS)-4-oxo-3-(phenylsulfanylmethyl)-2,3,3a,5,6,6a-hexahydropentalene-1,1-dicarboxylate.
| Compound Name | dimethyl (3aR,6aS)-4-oxo-3-(phenylsulfanylmethyl)-2,3,3a,5,6,6a-hexahydropentalene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 135010911 |
| Molecular Formula | C19H22O5S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | dimethyl (3aR,6aS)-4-oxo-3-(phenylsulfanylmethyl)-2,3,3a,5,6,6a-hexahydropentalene-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC(CSc2ccccc2)[C@@H]2C(=O)CC[C@@H]21 |
| InChI | InChI=1S/C19H22O5S/c1-23-17(21)19(18(22)24-2)10-12(16-14(19)8-9-15(16)20)11-25-13-6-4-3-5-7-13/h3-7,12,14,16H,8-11H2,1-2H3/t12?,14-,16-/m0/s1 |
| InChIKey | YLJFUTZHOFWGNU-DBQWNMKUSA-N |
| XLogP | 2.73 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|