C18H24O4S — CID 102072641
dimethyl 3,3-dimethyl-4-(phenylsulfanylmethyl)cyclopentane-1,1-dicarboxylate (PubChem CID 102072641) has the molecular formula C18H24O4S and a molecular weight of 336.45 g/mol. Its IUPAC name is dimethyl 3,3-dimethyl-4-(phenylsulfanylmethyl)cyclopentane-1,1-dicarboxylate.
| Compound Name | dimethyl 3,3-dimethyl-4-(phenylsulfanylmethyl)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 102072641 |
| Molecular Formula | C18H24O4S |
| Molecular Weight | 336.45 g/mol |
| Exact Mass | 336.14 |
| IUPAC Name | dimethyl 3,3-dimethyl-4-(phenylsulfanylmethyl)cyclopentane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC(CSc2ccccc2)C(C)(C)C1 |
| InChI | InChI=1S/C18H24O4S/c1-17(2)12-18(15(19)21-3,16(20)22-4)10-13(17)11-23-14-8-6-5-7-9-14/h5-9,13H,10-12H2,1-4H3 |
| InChIKey | CNYNLWRCPUSXLM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|