C17H22O2S — CID 134866212
methyl (2R)-2-[(1S)-3-methyl-2-(phenylsulfanylmethyl)cyclopent-2-en-1-yl]propanoate (PubChem CID 134866212) has the molecular formula C17H22O2S and a molecular weight of 290.43 g/mol. Its IUPAC name is methyl (2R)-2-[(1S)-3-methyl-2-(phenylsulfanylmethyl)cyclopent-2-en-1-yl]propanoate.
| Compound Name | methyl (2R)-2-[(1S)-3-methyl-2-(phenylsulfanylmethyl)cyclopent-2-en-1-yl]propanoate |
|---|---|
| PubChem CID | 134866212 |
| Molecular Formula | C17H22O2S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | methyl (2R)-2-[(1S)-3-methyl-2-(phenylsulfanylmethyl)cyclopent-2-en-1-yl]propanoate |
| SMILES | COC(=O)[C@H](C)[C@@H]1CCC(C)=C1CSc1ccccc1 |
| InChI | InChI=1S/C17H22O2S/c1-12-9-10-15(13(2)17(18)19-3)16(12)11-20-14-7-5-4-6-8-14/h4-8,13,15H,9-11H2,1-3H3/t13-,15+/m1/s1 |
| InChIKey | JFMBGDGHMAZJFQ-HIFRSBDPSA-N |
| XLogP | 4.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|