C17H18O3S — CID 135049980
methyl (3aS,6aR)-6-methyl-3-oxo-5-phenylsulfanyl-1,2,4,6a-tetrahydropentalene-3a-carboxylate (PubChem CID 135049980) has the molecular formula C17H18O3S and a molecular weight of 302.39 g/mol. Its IUPAC name is methyl (3aS,6aR)-6-methyl-3-oxo-5-phenylsulfanyl-1,2,4,6a-tetrahydropentalene-3a-carboxylate.
| Compound Name | methyl (3aS,6aR)-6-methyl-3-oxo-5-phenylsulfanyl-1,2,4,6a-tetrahydropentalene-3a-carboxylate |
|---|---|
| PubChem CID | 135049980 |
| Molecular Formula | C17H18O3S |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | methyl (3aS,6aR)-6-methyl-3-oxo-5-phenylsulfanyl-1,2,4,6a-tetrahydropentalene-3a-carboxylate |
| SMILES | COC(=O)[C@@]12CC(Sc3ccccc3)=C(C)[C@@H]1CCC2=O |
| InChI | InChI=1S/C17H18O3S/c1-11-13-8-9-15(18)17(13,16(19)20-2)10-14(11)21-12-6-4-3-5-7-12/h3-7,13H,8-10H2,1-2H3/t13-,17-/m0/s1 |
| InChIKey | FCWPIXMVOIAQKN-GUYCJALGSA-N |
| XLogP | 3.59 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|