C21H20O3S — CID 122221724
ethyl 2-oxo-1-(9H-thioxanthen-9-yl)cyclopentane-1-carboxylate (PubChem CID 122221724) has the molecular formula C21H20O3S and a molecular weight of 352.46 g/mol. Its IUPAC name is ethyl 2-oxo-1-(9H-thioxanthen-9-yl)cyclopentane-1-carboxylate.
| Compound Name | ethyl 2-oxo-1-(9H-thioxanthen-9-yl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 122221724 |
| Molecular Formula | C21H20O3S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | ethyl 2-oxo-1-(9H-thioxanthen-9-yl)cyclopentane-1-carboxylate |
| SMILES | CCOC(=O)C1(C2c3ccccc3Sc3ccccc32)CCCC1=O |
| InChI | InChI=1S/C21H20O3S/c1-2-24-20(23)21(13-7-12-18(21)22)19-14-8-3-5-10-16(14)25-17-11-6-4-9-15(17)19/h3-6,8-11,19H,2,7,12-13H2,1H3 |
| InChIKey | XWWRMTWTPNUTOR-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|