C22H22O4S — CID 71604631
diethyl 4-phenylsulfanyl-2H-naphthalene-1,1-dicarboxylate (PubChem CID 71604631) has the molecular formula C22H22O4S and a molecular weight of 382.48 g/mol. Its IUPAC name is diethyl 4-phenylsulfanyl-2H-naphthalene-1,1-dicarboxylate.
| Compound Name | diethyl 4-phenylsulfanyl-2H-naphthalene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 71604631 |
| Molecular Formula | C22H22O4S |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | diethyl 4-phenylsulfanyl-2H-naphthalene-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC=C(Sc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C22H22O4S/c1-3-25-20(23)22(21(24)26-4-2)15-14-19(17-12-8-9-13-18(17)22)27-16-10-6-5-7-11-16/h5-14H,3-4,15H2,1-2H3 |
| InChIKey | UWNOQTAXQNNEOA-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|