C19H24O4S — CID 135066729
diethyl 4-ethenyl-6-methylsulfanyl-3,4-dihydro-1H-naphthalene-2,2-dicarboxylate (PubChem CID 135066729) has the molecular formula C19H24O4S and a molecular weight of 348.46 g/mol. Its IUPAC name is diethyl 4-ethenyl-6-methylsulfanyl-3,4-dihydro-1H-naphthalene-2,2-dicarboxylate.
| Compound Name | diethyl 4-ethenyl-6-methylsulfanyl-3,4-dihydro-1H-naphthalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 135066729 |
| Molecular Formula | C19H24O4S |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | diethyl 4-ethenyl-6-methylsulfanyl-3,4-dihydro-1H-naphthalene-2,2-dicarboxylate |
| SMILES | C=CC1CC(C(=O)OCC)(C(=O)OCC)Cc2ccc(SC)cc21 |
| InChI | InChI=1S/C19H24O4S/c1-5-13-11-19(17(20)22-6-2,18(21)23-7-3)12-14-8-9-15(24-4)10-16(13)14/h5,8-10,13H,1,6-7,11-12H2,2-4H3 |
| InChIKey | RTBVNRHTPGNQSS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|