C23H20O8S3 — CID 15263206
tetramethyl spiro[1,3-dithiolane-5,9'-thioxanthene]-2,2,4,4-tetracarboxylate (PubChem CID 15263206) has the molecular formula C23H20O8S3 and a molecular weight of 520.61 g/mol. Its IUPAC name is tetramethyl spiro[1,3-dithiolane-5,9'-thioxanthene]-2,2,4,4-tetracarboxylate.
| Compound Name | tetramethyl spiro[1,3-dithiolane-5,9'-thioxanthene]-2,2,4,4-tetracarboxylate |
|---|---|
| PubChem CID | 15263206 |
| Molecular Formula | C23H20O8S3 |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.03 |
| IUPAC Name | tetramethyl spiro[1,3-dithiolane-5,9'-thioxanthene]-2,2,4,4-tetracarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)SC(C(=O)OC)(C(=O)OC)C2(S1)c1ccccc1Sc1ccccc12 |
| InChI | InChI=1S/C23H20O8S3/c1-28-17(24)22(18(25)29-2)21(33-23(34-22,19(26)30-3)20(27)31-4)13-9-5-7-11-15(13)32-16-12-8-6-10-14(16)21/h5-12H,1-4H3 |
| InChIKey | ZRPYWUNVSPNPMB-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|