C21H30O4S — CID 101376304
cis-dimethyl (2R,3R)-4,4-dimethyl-3-(phenylsulfanylmethyl)-2-propan-2-ylcyclopentane-1,1-dicarboxylate (PubChem CID 101376304) has the molecular formula C21H30O4S and a molecular weight of 378.53 g/mol. Its IUPAC name is cis-dimethyl (2R,3R)-4,4-dimethyl-3-(phenylsulfanylmethyl)-2-propan-2-ylcyclopentane-1,1-dicarboxylate.
| Compound Name | cis-dimethyl (2R,3R)-4,4-dimethyl-3-(phenylsulfanylmethyl)-2-propan-2-ylcyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 101376304 |
| Molecular Formula | C21H30O4S |
| Molecular Weight | 378.53 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | cis-dimethyl (2R,3R)-4,4-dimethyl-3-(phenylsulfanylmethyl)-2-propan-2-ylcyclopentane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC(C)(C)[C@H](CSc2ccccc2)[C@H]1C(C)C |
| InChI | InChI=1S/C21H30O4S/c1-14(2)17-16(12-26-15-10-8-7-9-11-15)20(3,4)13-21(17,18(22)24-5)19(23)25-6/h7-11,14,16-17H,12-13H2,1-6H3/t16-,17-/m1/s1 |
| InChIKey | ZEQHQKSZAPEYCJ-IAGOWNOFSA-N |
| XLogP | 4.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.53 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|