C21H26O2S — CID 15417046
methyl (1R,5S,6S,8S)-1,11,11-trimethyl-6-phenyl-3-thiatricyclo[6.2.1.02,7]undec-2(7)-ene-5-carboxylate (PubChem CID 15417046) has the molecular formula C21H26O2S and a molecular weight of 342.50 g/mol. Its IUPAC name is methyl (1R,5S,6S,8S)-1,11,11-trimethyl-6-phenyl-3-thiatricyclo[6.2.1.02,7]undec-2(7)-ene-5-carboxylate.
| Compound Name | methyl (1R,5S,6S,8S)-1,11,11-trimethyl-6-phenyl-3-thiatricyclo[6.2.1.02,7]undec-2(7)-ene-5-carboxylate |
|---|---|
| PubChem CID | 15417046 |
| Molecular Formula | C21H26O2S |
| Molecular Weight | 342.50 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | methyl (1R,5S,6S,8S)-1,11,11-trimethyl-6-phenyl-3-thiatricyclo[6.2.1.02,7]undec-2(7)-ene-5-carboxylate |
| SMILES | COC(=O)[C@H]1CSC2=C([C@@H]1c1ccccc1)[C@H]1CC[C@]2(C)C1(C)C |
| InChI | InChI=1S/C21H26O2S/c1-20(2)15-10-11-21(20,3)18-17(15)16(13-8-6-5-7-9-13)14(12-24-18)19(22)23-4/h5-9,14-16H,10-12H2,1-4H3/t14-,15+,16+,21-/m0/s1 |
| InChIKey | XFSNNWIUPDYDKJ-IWLLQYOYSA-N |
| XLogP | 5.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.50 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |