C19H26O4S — CID 11772492
methyl (2R)-2-[(1S)-3-acetyloxy-3-methyl-2-(phenylsulfanylmethyl)cyclopentyl]propanoate (PubChem CID 11772492) has the molecular formula C19H26O4S and a molecular weight of 350.48 g/mol. Its IUPAC name is methyl (2R)-2-[(1S)-3-acetyloxy-3-methyl-2-(phenylsulfanylmethyl)cyclopentyl]propanoate.
| Compound Name | methyl (2R)-2-[(1S)-3-acetyloxy-3-methyl-2-(phenylsulfanylmethyl)cyclopentyl]propanoate |
|---|---|
| PubChem CID | 11772492 |
| Molecular Formula | C19H26O4S |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | methyl (2R)-2-[(1S)-3-acetyloxy-3-methyl-2-(phenylsulfanylmethyl)cyclopentyl]propanoate |
| SMILES | COC(=O)[C@H](C)[C@@H]1CCC(C)(OC(C)=O)C1CSc1ccccc1 |
| InChI | InChI=1S/C19H26O4S/c1-13(18(21)22-4)16-10-11-19(3,23-14(2)20)17(16)12-24-15-8-6-5-7-9-15/h5-9,13,16-17H,10-12H2,1-4H3/t13-,16+,17?,19?/m1/s1 |
| InChIKey | IGQSIENPKUPAJL-IAWZGHHASA-N |
| XLogP | 3.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |