C20H28O4S — CID 11187650
trans-dimethyl (2S,3S)-2-hexyl-3-methyl-2-(1-thiophen-2-ylethenyl)cyclopropane-1,1-dicarboxylate (PubChem CID 11187650) has the molecular formula C20H28O4S and a molecular weight of 364.51 g/mol. Its IUPAC name is trans-dimethyl (2S,3S)-2-hexyl-3-methyl-2-(1-thiophen-2-ylethenyl)cyclopropane-1,1-dicarboxylate.
| Compound Name | trans-dimethyl (2S,3S)-2-hexyl-3-methyl-2-(1-thiophen-2-ylethenyl)cyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 11187650 |
| Molecular Formula | C20H28O4S |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | trans-dimethyl (2S,3S)-2-hexyl-3-methyl-2-(1-thiophen-2-ylethenyl)cyclopropane-1,1-dicarboxylate |
| SMILES | C=C(c1cccs1)[C@@]1(CCCCCC)[C@H](C)C1(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C20H28O4S/c1-6-7-8-9-12-19(14(2)16-11-10-13-25-16)15(3)20(19,17(21)23-4)18(22)24-5/h10-11,13,15H,2,6-9,12H2,1,3-5H3/t15-,19-/m0/s1 |
| InChIKey | ZKSWIELCHCNJRH-KXBFYZLASA-N |
| XLogP | 4.70 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|