C22H32O4S — CID 101376306
trans-dimethyl (2R,3S)-3-(phenylsulfanylmethyl)-2-propan-2-yl-4-propylcyclopentane-1,1-dicarboxylate (PubChem CID 101376306) has the molecular formula C22H32O4S and a molecular weight of 392.56 g/mol. Its IUPAC name is trans-dimethyl (2R,3S)-3-(phenylsulfanylmethyl)-2-propan-2-yl-4-propylcyclopentane-1,1-dicarboxylate.
| Compound Name | trans-dimethyl (2R,3S)-3-(phenylsulfanylmethyl)-2-propan-2-yl-4-propylcyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 101376306 |
| Molecular Formula | C22H32O4S |
| Molecular Weight | 392.56 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | trans-dimethyl (2R,3S)-3-(phenylsulfanylmethyl)-2-propan-2-yl-4-propylcyclopentane-1,1-dicarboxylate |
| SMILES | CCCC1CC(C(=O)OC)(C(=O)OC)[C@H](C(C)C)[C@H]1CSc1ccccc1 |
| InChI | InChI=1S/C22H32O4S/c1-6-10-16-13-22(20(23)25-4,21(24)26-5)19(15(2)3)18(16)14-27-17-11-8-7-9-12-17/h7-9,11-12,15-16,18-19H,6,10,13-14H2,1-5H3/t16?,18-,19+/m0/s1 |
| InChIKey | WUAAJBBKZOJRQJ-NGFYBIIMSA-N |
| XLogP | 4.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.56 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|