C18H22O6S — CID 134900727
dimethyl 4-ethenyl-1-(4-methylphenyl)sulfonylcyclopentane-1,3-dicarboxylate (PubChem CID 134900727) has the molecular formula C18H22O6S and a molecular weight of 366.44 g/mol. Its IUPAC name is dimethyl 4-ethenyl-1-(4-methylphenyl)sulfonylcyclopentane-1,3-dicarboxylate.
| Compound Name | dimethyl 4-ethenyl-1-(4-methylphenyl)sulfonylcyclopentane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 134900727 |
| Molecular Formula | C18H22O6S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | dimethyl 4-ethenyl-1-(4-methylphenyl)sulfonylcyclopentane-1,3-dicarboxylate |
| SMILES | C=CC1CC(C(=O)OC)(S(=O)(=O)c2ccc(C)cc2)CC1C(=O)OC |
| InChI | InChI=1S/C18H22O6S/c1-5-13-10-18(17(20)24-4,11-15(13)16(19)23-3)25(21,22)14-8-6-12(2)7-9-14/h5-9,13,15H,1,10-11H2,2-4H3 |
| InChIKey | ARONYWFJBBYQIH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|