C14H17IO4S — CID 134934563
cis-methyl (1S,2R)-1-(benzenesulfonyl)-2-(iodomethyl)cyclopentane-1-carboxylate (PubChem CID 134934563) has the molecular formula C14H17IO4S and a molecular weight of 408.26 g/mol. Its IUPAC name is cis-methyl (1S,2R)-1-(benzenesulfonyl)-2-(iodomethyl)cyclopentane-1-carboxylate.
| Compound Name | cis-methyl (1S,2R)-1-(benzenesulfonyl)-2-(iodomethyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 134934563 |
| Molecular Formula | C14H17IO4S |
| Molecular Weight | 408.26 g/mol |
| Exact Mass | 407.99 |
| IUPAC Name | cis-methyl (1S,2R)-1-(benzenesulfonyl)-2-(iodomethyl)cyclopentane-1-carboxylate |
| SMILES | COC(=O)[C@]1(S(=O)(=O)c2ccccc2)CCC[C@H]1CI |
| InChI | InChI=1S/C14H17IO4S/c1-19-13(16)14(9-5-6-11(14)10-15)20(17,18)12-7-3-2-4-8-12/h2-4,7-8,11H,5-6,9-10H2,1H3/t11-,14-/m0/s1 |
| InChIKey | WXGMDYBHIMERFK-FZMZJTMJSA-N |
| XLogP | 2.61 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.26 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|