C16H15F3O4S — CID 102281938
(1R,2R,3S,4S)-2-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 102281938) has the molecular formula C16H15F3O4S and a molecular weight of 360.35 g/mol. Its IUPAC name is (1R,2R,3S,4S)-2-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | (1R,2R,3S,4S)-2-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 102281938 |
| Molecular Formula | C16H15F3O4S |
| Molecular Weight | 360.35 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | (1R,2R,3S,4S)-2-(4-methylphenyl)sulfonyl-3-(trifluoromethyl)bicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | Cc1ccc(S(=O)(=O)[C@]2(C(=O)O)[C@H]3C=C[C@H](C3)[C@H]2C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H15F3O4S/c1-9-2-6-12(7-3-9)24(22,23)15(14(20)21)11-5-4-10(8-11)13(15)16(17,18)19/h2-7,10-11,13H,8H2,1H3,(H,20,21)/t10-,11+,13-,15-/m1/s1 |
| InChIKey | CXVLXNYVXYFSLY-NDPMZMCLSA-N |
| XLogP | 2.98 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|