C14H14O2S — CID 135039403
2-phenylsulfanylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid (PubChem CID 135039403) has the molecular formula C14H14O2S and a molecular weight of 246.33 g/mol. Its IUPAC name is 2-phenylsulfanylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid.
| Compound Name | 2-phenylsulfanylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 135039403 |
| Molecular Formula | C14H14O2S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 2-phenylsulfanylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid |
| SMILES | O=C(O)C1(Sc2ccccc2)CC2C=CC1C2 |
| InChI | InChI=1S/C14H14O2S/c15-13(16)14(9-10-6-7-11(14)8-10)17-12-4-2-1-3-5-12/h1-7,10-11H,8-9H2,(H,15,16) |
| InChIKey | HYGHELOZYMOHLS-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|