C16H15F3O2S — CID 12036234
2,2,2-trifluoroethyl (1S,2R,4S)-2-phenylsulfanylbicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 12036234) has the molecular formula C16H15F3O2S and a molecular weight of 328.36 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl (1S,2R,4S)-2-phenylsulfanylbicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | 2,2,2-trifluoroethyl (1S,2R,4S)-2-phenylsulfanylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 12036234 |
| Molecular Formula | C16H15F3O2S |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 2,2,2-trifluoroethyl (1S,2R,4S)-2-phenylsulfanylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C(OCC(F)(F)F)[C@@]1(Sc2ccccc2)C[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C16H15F3O2S/c17-16(18,19)10-21-14(20)15(9-11-6-7-12(15)8-11)22-13-4-2-1-3-5-13/h1-7,11-12H,8-10H2/t11-,12+,15+/m0/s1 |
| InChIKey | UCOIANKKOVXRHA-YWPYICTPSA-N |
| XLogP | 4.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|