C17H20O4S — CID 139948523
ethyl 1-(4-methylphenyl)sulfonylbicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 139948523) has the molecular formula C17H20O4S and a molecular weight of 320.41 g/mol. Its IUPAC name is ethyl 1-(4-methylphenyl)sulfonylbicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | ethyl 1-(4-methylphenyl)sulfonylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 139948523 |
| Molecular Formula | C17H20O4S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.11 |
| IUPAC Name | ethyl 1-(4-methylphenyl)sulfonylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CCOC(=O)C1CC2C=CC1(S(=O)(=O)c1ccc(C)cc1)C2 |
| InChI | InChI=1S/C17H20O4S/c1-3-21-16(18)15-10-13-8-9-17(15,11-13)22(19,20)14-6-4-12(2)5-7-14/h4-9,13,15H,3,10-11H2,1-2H3 |
| InChIKey | WASCWTSEVRXHMA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|