C16H17FO4S — CID 102456409
ethyl (1R,2R,3R,4S)-3-(4-fluorophenyl)sulfonylbicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 102456409) has the molecular formula C16H17FO4S and a molecular weight of 324.37 g/mol. Its IUPAC name is ethyl (1R,2R,3R,4S)-3-(4-fluorophenyl)sulfonylbicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | ethyl (1R,2R,3R,4S)-3-(4-fluorophenyl)sulfonylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 102456409 |
| Molecular Formula | C16H17FO4S |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | ethyl (1R,2R,3R,4S)-3-(4-fluorophenyl)sulfonylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H](S(=O)(=O)c2ccc(F)cc2)[C@@H]2C=C[C@H]1C2 |
| InChI | InChI=1S/C16H17FO4S/c1-2-21-16(18)14-10-3-4-11(9-10)15(14)22(19,20)13-7-5-12(17)6-8-13/h3-8,10-11,14-15H,2,9H2,1H3/t10-,11+,14-,15+/m0/s1 |
| InChIKey | ZGDHMEXXACAICO-IDTSFGKNSA-N |
| XLogP | 2.35 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|