C17H22F2O2S — CID 102444910
ethyl 3-cyclohexyl-2,2-difluoro-3-phenylsulfanylpropanoate (PubChem CID 102444910) has the molecular formula C17H22F2O2S and a molecular weight of 328.42 g/mol. Its IUPAC name is ethyl 3-cyclohexyl-2,2-difluoro-3-phenylsulfanylpropanoate.
| Compound Name | ethyl 3-cyclohexyl-2,2-difluoro-3-phenylsulfanylpropanoate |
|---|---|
| PubChem CID | 102444910 |
| Molecular Formula | C17H22F2O2S |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | ethyl 3-cyclohexyl-2,2-difluoro-3-phenylsulfanylpropanoate |
| SMILES | CCOC(=O)C(F)(F)C(Sc1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C17H22F2O2S/c1-2-21-16(20)17(18,19)15(13-9-5-3-6-10-13)22-14-11-7-4-8-12-14/h4,7-8,11-13,15H,2-3,5-6,9-10H2,1H3 |
| InChIKey | UMFADAXMYOFPSD-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |